C19H26N2 — CID 90705010
9-(2-ethenyl-6-methylcyclohexa-2,4-dien-1-yl)-2-methyl-4,4a,5,6,7,8-hexahydro-1H-cyclohepta[d]pyrimidine (PubChem CID 90705010) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 9-(2-ethenyl-6-methylcyclohexa-2,4-dien-1-yl)-2-methyl-4,4a,5,6,7,8-hexahydro-1H-cyclohepta[d]pyrimidine.
| Compound Name | 9-(2-ethenyl-6-methylcyclohexa-2,4-dien-1-yl)-2-methyl-4,4a,5,6,7,8-hexahydro-1H-cyclohepta[d]pyrimidine |
|---|---|
| PubChem CID | 90705010 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 9-(2-ethenyl-6-methylcyclohexa-2,4-dien-1-yl)-2-methyl-4,4a,5,6,7,8-hexahydro-1H-cyclohepta[d]pyrimidine |
| SMILES | C=CC1=CC=CC(C)C1C1=C2NC(C)=NCC2CCCC1 |
| InChI | InChI=1S/C19H26N2/c1-4-15-10-7-8-13(2)18(15)17-11-6-5-9-16-12-20-14(3)21-19(16)17/h4,7-8,10,13,16,18H,1,5-6,9,11-12H2,2-3H3,(H,20,21) |
| InChIKey | MVZXMMQZAWVFTH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |