C17H29N3 — CID 163530954
(3R,5S)-N-[4-(aminomethyl)-5-propan-2-ylcyclohexa-1,3-dien-1-yl]-3,5-dimethyl-2,3,4,5-tetrahydropyridin-6-amine (PubChem CID 163530954) has the molecular formula C17H29N3 and a molecular weight of 275.44 g/mol. Its IUPAC name is (3R,5S)-N-[4-(aminomethyl)-5-propan-2-ylcyclohexa-1,3-dien-1-yl]-3,5-dimethyl-2,3,4,5-tetrahydropyridin-6-amine.
| Compound Name | (3R,5S)-N-[4-(aminomethyl)-5-propan-2-ylcyclohexa-1,3-dien-1-yl]-3,5-dimethyl-2,3,4,5-tetrahydropyridin-6-amine |
|---|---|
| PubChem CID | 163530954 |
| Molecular Formula | C17H29N3 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | (3R,5S)-N-[4-(aminomethyl)-5-propan-2-ylcyclohexa-1,3-dien-1-yl]-3,5-dimethyl-2,3,4,5-tetrahydropyridin-6-amine |
| SMILES | CC(C)C1CC(NC2=NC[C@H](C)C[C@@H]2C)=CC=C1CN |
| InChI | InChI=1S/C17H29N3/c1-11(2)16-8-15(6-5-14(16)9-18)20-17-13(4)7-12(3)10-19-17/h5-6,11-13,16H,7-10,18H2,1-4H3,(H,19,20)/t12-,13+,16?/m1/s1 |
| InChIKey | DSYLSTAQYNWVMT-IMSGDLLMSA-N |
| XLogP | 3.10 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |