C37H31N5 — CID 145340962
3-N-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10,10-dimethyl-6H-benzo[a]azulene-2,3-diamine (PubChem CID 145340962) has the molecular formula C37H31N5 and a molecular weight of 545.69 g/mol. Its IUPAC name is 3-N-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10,10-dimethyl-6H-benzo[a]azulene-2,3-diamine.
| Compound Name | 3-N-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10,10-dimethyl-6H-benzo[a]azulene-2,3-diamine |
|---|---|
| PubChem CID | 145340962 |
| Molecular Formula | C37H31N5 |
| Molecular Weight | 545.69 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | 3-N-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10,10-dimethyl-6H-benzo[a]azulene-2,3-diamine |
| SMILES | CC1(C)C2=CC=CCC=C2c2cc(Nc3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)c(N)cc21 |
| InChI | InChI=1S/C37H31N5/c1-37(2)30-17-11-5-10-16-28(30)29-22-33(32(38)23-31(29)37)39-27-20-18-26(19-21-27)36-41-34(24-12-6-3-7-13-24)40-35(42-36)25-14-8-4-9-15-25/h3-9,11-23,39H,10,38H2,1-2H3 |
| InChIKey | UWZIXFVGFIUVFO-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.69 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|