C37H38N6O7S3 — CID 145342908
N-[5-[(3,4-dimethoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-(2-methoxyphenyl)acetamide;N-[5-[(3,4-dimethoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-thiophen-2-ylacetamide (PubChem CID 145342908) has the molecular formula C37H38N6O7S3 and a molecular weight of 774.95 g/mol. Its IUPAC name is N-[5-[(3,4-dimethoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-(2-methoxyphenyl)acetamide;N-[5-[(3,4-dimethoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[5-[(3,4-dimethoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-(2-methoxyphenyl)acetamide;N-[5-[(3,4-dimethoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 145342908 |
| Molecular Formula | C37H38N6O7S3 |
| Molecular Weight | 774.95 g/mol |
| Exact Mass | 774.20 |
| IUPAC Name | N-[5-[(3,4-dimethoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-(2-methoxyphenyl)acetamide;N-[5-[(3,4-dimethoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-thiophen-2-ylacetamide |
| SMILES | COc1ccc(Cc2nnc(NC(=O)Cc3cccs3)s2)cc1OC.COc1ccccc1CC(=O)Nc1nnc(Cc2ccc(OC)c(OC)c2)s1 |
| InChI | InChI=1S/C20H21N3O4S.C17H17N3O3S2/c1-25-15-7-5-4-6-14(15)12-18(24)21-20-23-22-19(28-20)11-13-8-9-16(26-2)17(10-13)27-3;1-22-13-6-5-11(8-14(13)23-2)9-16-19-20-17(25-16)18-15(21)10-12-4-3-7-24-12/h4-10H,11-12H2,1-3H3,(H,21,23,24);3-8H,9-10H2,1-2H3,(H,18,20,21) |
| InChIKey | KKDRTRWJECIMPX-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 155.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.95 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |