C22H22F3N3O5S — CID 45489469
N-[5-[(3,4-dimethoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-(2-methylphenyl)acetamide;2,2,2-trifluoroacetic acid (PubChem CID 45489469) has the molecular formula C22H22F3N3O5S and a molecular weight of 497.50 g/mol. Its IUPAC name is N-[5-[(3,4-dimethoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-(2-methylphenyl)acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[5-[(3,4-dimethoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-(2-methylphenyl)acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 45489469 |
| Molecular Formula | C22H22F3N3O5S |
| Molecular Weight | 497.50 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | N-[5-[(3,4-dimethoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-(2-methylphenyl)acetamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(Cc2nnc(NC(=O)Cc3ccccc3C)s2)cc1OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H21N3O3S.C2HF3O2/c1-13-6-4-5-7-15(13)12-18(24)21-20-23-22-19(27-20)11-14-8-9-16(25-2)17(10-14)26-3;3-2(4,5)1(6)7/h4-10H,11-12H2,1-3H3,(H,21,23,24);(H,6,7) |
| InChIKey | YGIUVPMHBPMPHK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 110.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |