C28H23F3N4O6S — CID 46238382
N-[5-[(3,4-dimethoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-(5-methylfuran-2-yl)quinoline-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 46238382) has the molecular formula C28H23F3N4O6S and a molecular weight of 600.58 g/mol. Its IUPAC name is N-[5-[(3,4-dimethoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-(5-methylfuran-2-yl)quinoline-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[5-[(3,4-dimethoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-(5-methylfuran-2-yl)quinoline-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 46238382 |
| Molecular Formula | C28H23F3N4O6S |
| Molecular Weight | 600.58 g/mol |
| Exact Mass | 600.13 |
| IUPAC Name | N-[5-[(3,4-dimethoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]-2-(5-methylfuran-2-yl)quinoline-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(Cc2nnc(NC(=O)c3cc(-c4ccc(C)o4)nc4ccccc34)s2)cc1OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H22N4O4S.C2HF3O2/c1-15-8-10-21(34-15)20-14-18(17-6-4-5-7-19(17)27-20)25(31)28-26-30-29-24(35-26)13-16-9-11-22(32-2)23(12-16)33-3;3-2(4,5)1(6)7/h4-12,14H,13H2,1-3H3,(H,28,30,31);(H,6,7) |
| InChIKey | JJOGLLCWGPZDHV-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 136.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.58 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |