C22H24N2O4 — CID 1453431
4-ethoxy-N-(2-hydroxyethyl)-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide (PubChem CID 1453431) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 4-ethoxy-N-(2-hydroxyethyl)-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide.
| Compound Name | 4-ethoxy-N-(2-hydroxyethyl)-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 1453431 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 4-ethoxy-N-(2-hydroxyethyl)-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide |
| SMILES | CCOc1ccc(C(=O)N(CCO)Cc2cc3cc(C)ccc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C22H24N2O4/c1-3-28-19-7-5-16(6-8-19)22(27)24(10-11-25)14-18-13-17-12-15(2)4-9-20(17)23-21(18)26/h4-9,12-13,25H,3,10-11,14H2,1-2H3,(H,23,26) |
| InChIKey | MBSDUHNVWJJYRV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |