C26H30N6OS — CID 145343942
ethane;N-(2-methylpyrazol-3-yl)-4-[1-(2-phenylethoxysulfanyl)-2,3-dihydroindol-5-yl]pyrimidin-2-amine (PubChem CID 145343942) has the molecular formula C26H30N6OS and a molecular weight of 474.63 g/mol. Its IUPAC name is ethane;N-(2-methylpyrazol-3-yl)-4-[1-(2-phenylethoxysulfanyl)-2,3-dihydroindol-5-yl]pyrimidin-2-amine.
| Compound Name | ethane;N-(2-methylpyrazol-3-yl)-4-[1-(2-phenylethoxysulfanyl)-2,3-dihydroindol-5-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 145343942 |
| Molecular Formula | C26H30N6OS |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | ethane;N-(2-methylpyrazol-3-yl)-4-[1-(2-phenylethoxysulfanyl)-2,3-dihydroindol-5-yl]pyrimidin-2-amine |
| SMILES | CC.Cn1nccc1Nc1nccc(-c2ccc3c(c2)CCN3SOCCc2ccccc2)n1 |
| InChI | InChI=1S/C24H24N6OS.C2H6/c1-29-23(10-14-26-29)28-24-25-13-9-21(27-24)19-7-8-22-20(17-19)11-15-30(22)32-31-16-12-18-5-3-2-4-6-18;1-2/h2-10,13-14,17H,11-12,15-16H2,1H3,(H,25,27,28);1-2H3 |
| InChIKey | XDHJZCGNNNRQCZ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|