C18H22F2N4 — CID 145344172
1-[(2R,3S)-3-(2,4-difluorophenyl)-4-(1,2,4-triazol-1-yl)butan-2-yl]-4-methylidenepiperidine (PubChem CID 145344172) has the molecular formula C18H22F2N4 and a molecular weight of 332.40 g/mol. Its IUPAC name is 1-[(2R,3S)-3-(2,4-difluorophenyl)-4-(1,2,4-triazol-1-yl)butan-2-yl]-4-methylidenepiperidine.
| Compound Name | 1-[(2R,3S)-3-(2,4-difluorophenyl)-4-(1,2,4-triazol-1-yl)butan-2-yl]-4-methylidenepiperidine |
|---|---|
| PubChem CID | 145344172 |
| Molecular Formula | C18H22F2N4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 1-[(2R,3S)-3-(2,4-difluorophenyl)-4-(1,2,4-triazol-1-yl)butan-2-yl]-4-methylidenepiperidine |
| SMILES | C=C1CCN([C@H](C)[C@H](Cn2cncn2)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C18H22F2N4/c1-13-5-7-23(8-6-13)14(2)17(10-24-12-21-11-22-24)16-4-3-15(19)9-18(16)20/h3-4,9,11-12,14,17H,1,5-8,10H2,2H3/t14-,17+/m1/s1 |
| InChIKey | PSQLFRAMDVKEDN-PBHICJAKSA-N |
| XLogP | 3.38 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|