C13H13F2N6O4P — CID 95731722
[(1R,2R)-2-(2,4-difluorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propyl] dihydrogen phosphate (PubChem CID 95731722) has the molecular formula C13H13F2N6O4P and a molecular weight of 386.26 g/mol. Its IUPAC name is [(1R,2R)-2-(2,4-difluorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propyl] dihydrogen phosphate.
| Compound Name | [(1R,2R)-2-(2,4-difluorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 95731722 |
| Molecular Formula | C13H13F2N6O4P |
| Molecular Weight | 386.26 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | [(1R,2R)-2-(2,4-difluorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propyl] dihydrogen phosphate |
| SMILES | O=P(O)(O)O[C@H]([C@@H](Cn1cncn1)c1ccc(F)cc1F)n1cncn1 |
| InChI | InChI=1S/C13H13F2N6O4P/c14-9-1-2-10(12(15)3-9)11(4-20-7-16-5-18-20)13(25-26(22,23)24)21-8-17-6-19-21/h1-3,5-8,11,13H,4H2,(H2,22,23,24)/t11-,13+/m0/s1 |
| InChIKey | PNMUSHBRCLLUDK-WCQYABFASA-N |
| XLogP | 1.24 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|