C23H25F3O4 — CID 145345591
5-[4-(trifluoromethyl)benzoyl]oxyhexan-2-yl 3,5-dimethylbenzoate (PubChem CID 145345591) has the molecular formula C23H25F3O4 and a molecular weight of 422.44 g/mol. Its IUPAC name is 5-[4-(trifluoromethyl)benzoyl]oxyhexan-2-yl 3,5-dimethylbenzoate.
| Compound Name | 5-[4-(trifluoromethyl)benzoyl]oxyhexan-2-yl 3,5-dimethylbenzoate |
|---|---|
| PubChem CID | 145345591 |
| Molecular Formula | C23H25F3O4 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 5-[4-(trifluoromethyl)benzoyl]oxyhexan-2-yl 3,5-dimethylbenzoate |
| SMILES | Cc1cc(C)cc(C(=O)OC(C)CCC(C)OC(=O)c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C23H25F3O4/c1-14-11-15(2)13-19(12-14)22(28)30-17(4)6-5-16(3)29-21(27)18-7-9-20(10-8-18)23(24,25)26/h7-13,16-17H,5-6H2,1-4H3 |
| InChIKey | WUXKCPIMLOZHJM-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |