C37H39N — CID 145346084
N-(4-ethenylphenyl)-4-ethyl-N-[4-[4-(1-ethyl-3-methylidenecyclohexyl)phenyl]phenyl]aniline (PubChem CID 145346084) has the molecular formula C37H39N and a molecular weight of 497.73 g/mol. Its IUPAC name is N-(4-ethenylphenyl)-4-ethyl-N-[4-[4-(1-ethyl-3-methylidenecyclohexyl)phenyl]phenyl]aniline.
| Compound Name | N-(4-ethenylphenyl)-4-ethyl-N-[4-[4-(1-ethyl-3-methylidenecyclohexyl)phenyl]phenyl]aniline |
|---|---|
| PubChem CID | 145346084 |
| Molecular Formula | C37H39N |
| Molecular Weight | 497.73 g/mol |
| Exact Mass | 497.31 |
| IUPAC Name | N-(4-ethenylphenyl)-4-ethyl-N-[4-[4-(1-ethyl-3-methylidenecyclohexyl)phenyl]phenyl]aniline |
| SMILES | C=Cc1ccc(N(c2ccc(CC)cc2)c2ccc(-c3ccc(C4(CC)CCCC(=C)C4)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H39N/c1-5-29-10-20-34(21-11-29)38(35-22-12-30(6-2)13-23-35)36-24-16-32(17-25-36)31-14-18-33(19-15-31)37(7-3)26-8-9-28(4)27-37/h5,10-25H,1,4,6-9,26-27H2,2-3H3 |
| InChIKey | XOZQGYZBPJXVDE-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.73 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|