About 1-ethenyl-4-ethylbenzene;pyrrolidine
1-ethenyl-4-ethylbenzene;pyrrolidine (PubChem CID 174791153) has the molecular formula C14H21N
and a molecular weight of 203.33 g/mol. Its IUPAC name is 1-ethenyl-4-ethylbenzene;pyrrolidine.
Molecular Properties
| Compound Name | 1-ethenyl-4-ethylbenzene;pyrrolidine |
| PubChem CID | 174791153 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 1-ethenyl-4-ethylbenzene;pyrrolidine |
| SMILES | C1CCNC1.C=Cc1ccc(CC)cc1 |
| InChI | InChI=1S/C10H12.C4H9N/c1-3-9-5-7-10(4-2)8-6-9;1-2-4-5-3-1/h3,5-8H,1,4H2,2H3;5H,1-4H2 |
| InChIKey | HHUQLMMDYJKITK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethenyl-4-ethylbenzene;pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-4-ethylbenzene;pyrrolidine?
The IUPAC name of 1-ethenyl-4-ethylbenzene;pyrrolidine (CID 174791153) is 1-ethenyl-4-ethylbenzene;pyrrolidine.
What is the SMILES notation for 1-ethenyl-4-ethylbenzene;pyrrolidine?
The canonical SMILES for 1-ethenyl-4-ethylbenzene;pyrrolidine is C1CCNC1.C=Cc1ccc(CC)cc1.
What is the InChIKey of 1-ethenyl-4-ethylbenzene;pyrrolidine?
The InChIKey is HHUQLMMDYJKITK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12.C4H9N/c1-3-9-5-7-10(4-2)8-6-9;1-2-4-5-3-1/h3,5-8H,1,4H2,2H3;5H,1-4H2.
What are the key properties of 1-ethenyl-4-ethylbenzene;pyrrolidine?
1-ethenyl-4-ethylbenzene;pyrrolidine has a molecular weight of 203.33 g/mol, XLogP of 3.26, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-4-ethylbenzene;pyrrolidine is sourced from PubChem (CID 174791153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).