C14H21N — CID 174791153
1-ethenyl-4-ethylbenzene;pyrrolidine (PubChem CID 174791153) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 1-ethenyl-4-ethylbenzene;pyrrolidine.
| Compound Name | 1-ethenyl-4-ethylbenzene;pyrrolidine |
|---|---|
| PubChem CID | 174791153 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 1-ethenyl-4-ethylbenzene;pyrrolidine |
| SMILES | C1CCNC1.C=Cc1ccc(CC)cc1 |
| InChI | InChI=1S/C10H12.C4H9N/c1-3-9-5-7-10(4-2)8-6-9;1-2-4-5-3-1/h3,5-8H,1,4H2,2H3;5H,1-4H2 |
| InChIKey | HHUQLMMDYJKITK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |