About 1-ethenyl-4-propan-2-ylbenzene;1-ethyl-4-methylbenzene;hydrate
1-ethenyl-4-propan-2-ylbenzene;1-ethyl-4-methylbenzene;hydrate (PubChem CID 142132949) has the molecular formula C20H28O
and a molecular weight of 284.44 g/mol. Its IUPAC name is 1-ethenyl-4-propan-2-ylbenzene;1-ethyl-4-methylbenzene;hydrate.
Molecular Properties
| Compound Name | 1-ethenyl-4-propan-2-ylbenzene;1-ethyl-4-methylbenzene;hydrate |
| PubChem CID | 142132949 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 1-ethenyl-4-propan-2-ylbenzene;1-ethyl-4-methylbenzene;hydrate |
| SMILES | C=Cc1ccc(C(C)C)cc1.CCc1ccc(C)cc1.O |
| InChI | InChI=1S/C11H14.C9H12.H2O/c1-4-10-5-7-11(8-6-10)9(2)3;1-3-9-6-4-8(2)5-7-9;/h4-9H,1H2,2-3H3;4-7H,3H2,1-2H3;1H2 |
| InChIKey | QNIQHYBXLHZDLM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-ethenyl-4-propan-2-ylbenzene;1-ethyl-4-methylbenzene;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-4-propan-2-ylbenzene;1-ethyl-4-methylbenzene;hydrate?
The IUPAC name of 1-ethenyl-4-propan-2-ylbenzene;1-ethyl-4-methylbenzene;hydrate (CID 142132949) is 1-ethenyl-4-propan-2-ylbenzene;1-ethyl-4-methylbenzene;hydrate.
What is the SMILES notation for 1-ethenyl-4-propan-2-ylbenzene;1-ethyl-4-methylbenzene;hydrate?
The canonical SMILES for 1-ethenyl-4-propan-2-ylbenzene;1-ethyl-4-methylbenzene;hydrate is C=Cc1ccc(C(C)C)cc1.CCc1ccc(C)cc1.O.
What is the InChIKey of 1-ethenyl-4-propan-2-ylbenzene;1-ethyl-4-methylbenzene;hydrate?
The InChIKey is QNIQHYBXLHZDLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14.C9H12.H2O/c1-4-10-5-7-11(8-6-10)9(2)3;1-3-9-6-4-8(2)5-7-9;/h4-9H,1H2,2-3H3;4-7H,3H2,1-2H3;1H2.
What are the key properties of 1-ethenyl-4-propan-2-ylbenzene;1-ethyl-4-methylbenzene;hydrate?
1-ethenyl-4-propan-2-ylbenzene;1-ethyl-4-methylbenzene;hydrate has a molecular weight of 284.44 g/mol, XLogP of 5.19, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-4-propan-2-ylbenzene;1-ethyl-4-methylbenzene;hydrate is sourced from PubChem (CID 142132949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).