C16H23N3 — CID 145347439
ethane;2-(3-methylpyrazol-1-yl)pyridine;(3Z)-penta-1,3-diene (PubChem CID 145347439) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is ethane;2-(3-methylpyrazol-1-yl)pyridine;(3Z)-penta-1,3-diene.
| Compound Name | ethane;2-(3-methylpyrazol-1-yl)pyridine;(3Z)-penta-1,3-diene |
|---|---|
| PubChem CID | 145347439 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | ethane;2-(3-methylpyrazol-1-yl)pyridine;(3Z)-penta-1,3-diene |
| SMILES | C=C/C=C\C.CC.Cc1ccn(-c2ccccn2)n1 |
| InChI | InChI=1S/C9H9N3.C5H8.C2H6/c1-8-5-7-12(11-8)9-4-2-3-6-10-9;1-3-5-4-2;1-2/h2-7H,1H3;3-5H,1H2,2H3;1-2H3/b;5-4-; |
| InChIKey | FTYQQRPJDUSFBF-FXHNQCOHSA-N |
| XLogP | 4.35 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|