C30H28 — CID 145347893
2-[(2E,4E,6Z)-4,5-dimethyl-6-naphthalen-2-ylocta-2,4,6-trien-2-yl]naphthalene (PubChem CID 145347893) has the molecular formula C30H28 and a molecular weight of 388.55 g/mol. Its IUPAC name is 2-[(2E,4E,6Z)-4,5-dimethyl-6-naphthalen-2-ylocta-2,4,6-trien-2-yl]naphthalene.
| Compound Name | 2-[(2E,4E,6Z)-4,5-dimethyl-6-naphthalen-2-ylocta-2,4,6-trien-2-yl]naphthalene |
|---|---|
| PubChem CID | 145347893 |
| Molecular Formula | C30H28 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 2-[(2E,4E,6Z)-4,5-dimethyl-6-naphthalen-2-ylocta-2,4,6-trien-2-yl]naphthalene |
| SMILES | C/C=C(C(\C)=C(C)\C=C(/C)c1ccc2ccccc2c1)/c1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H28/c1-5-30(29-17-15-25-11-7-9-13-28(25)20-29)23(4)21(2)18-22(3)26-16-14-24-10-6-8-12-27(24)19-26/h5-20H,1-4H3/b22-18+,23-21+,30-5+ |
| InChIKey | NPNVCUVJMGXJSH-GSAWKNRJSA-N |
| XLogP | 8.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|