C13H18ClNOS2 — CID 145350303
3-(4-chlorophenyl)-N-[1-(methyldisulfanyl)propan-2-yl]propanamide (PubChem CID 145350303) has the molecular formula C13H18ClNOS2 and a molecular weight of 303.88 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[1-(methyldisulfanyl)propan-2-yl]propanamide.
| Compound Name | 3-(4-chlorophenyl)-N-[1-(methyldisulfanyl)propan-2-yl]propanamide |
|---|---|
| PubChem CID | 145350303 |
| Molecular Formula | C13H18ClNOS2 |
| Molecular Weight | 303.88 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[1-(methyldisulfanyl)propan-2-yl]propanamide |
| SMILES | CSSCC(C)NC(=O)CCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H18ClNOS2/c1-10(9-18-17-2)15-13(16)8-5-11-3-6-12(14)7-4-11/h3-4,6-7,10H,5,8-9H2,1-2H3,(H,15,16) |
| InChIKey | OLEMZEQMOWQYFH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.88 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|