C18H26F2N4O — CID 145352011
1-cyclohexyl-2-[4-(1-fluoroethyl)-4,5,8,10-tetrazatricyclo[6.3.0.02,6]undeca-1(11),2,5,9-tetraen-7-yl]ethanol;fluoromethane (PubChem CID 145352011) has the molecular formula C18H26F2N4O and a molecular weight of 352.43 g/mol. Its IUPAC name is 1-cyclohexyl-2-[4-(1-fluoroethyl)-4,5,8,10-tetrazatricyclo[6.3.0.02,6]undeca-1(11),2,5,9-tetraen-7-yl]ethanol;fluoromethane.
| Compound Name | 1-cyclohexyl-2-[4-(1-fluoroethyl)-4,5,8,10-tetrazatricyclo[6.3.0.02,6]undeca-1(11),2,5,9-tetraen-7-yl]ethanol;fluoromethane |
|---|---|
| PubChem CID | 145352011 |
| Molecular Formula | C18H26F2N4O |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | 1-cyclohexyl-2-[4-(1-fluoroethyl)-4,5,8,10-tetrazatricyclo[6.3.0.02,6]undeca-1(11),2,5,9-tetraen-7-yl]ethanol;fluoromethane |
| SMILES | CC(F)n1cc2c(n1)C(CC(O)C1CCCCC1)n1cncc1-2.CF |
| InChI | InChI=1S/C17H23FN4O.CH3F/c1-11(18)22-9-13-15-8-19-10-21(15)14(17(13)20-22)7-16(23)12-5-3-2-4-6-12;1-2/h8-12,14,16,23H,2-7H2,1H3;1H3 |
| InChIKey | CHZVWNNPFODQKK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |