C15H15N3S3 — CID 145352747
[5-[3-methylsulfanyl-5-(1H-pyrazol-4-yl)phenyl]sulfanylthiophen-2-yl]methanamine (PubChem CID 145352747) has the molecular formula C15H15N3S3 and a molecular weight of 333.51 g/mol. Its IUPAC name is [5-[3-methylsulfanyl-5-(1H-pyrazol-4-yl)phenyl]sulfanylthiophen-2-yl]methanamine.
| Compound Name | [5-[3-methylsulfanyl-5-(1H-pyrazol-4-yl)phenyl]sulfanylthiophen-2-yl]methanamine |
|---|---|
| PubChem CID | 145352747 |
| Molecular Formula | C15H15N3S3 |
| Molecular Weight | 333.51 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | [5-[3-methylsulfanyl-5-(1H-pyrazol-4-yl)phenyl]sulfanylthiophen-2-yl]methanamine |
| SMILES | CSc1cc(Sc2ccc(CN)s2)cc(-c2cn[nH]c2)c1 |
| InChI | InChI=1S/C15H15N3S3/c1-19-13-4-10(11-8-17-18-9-11)5-14(6-13)21-15-3-2-12(7-16)20-15/h2-6,8-9H,7,16H2,1H3,(H,17,18) |
| InChIKey | JKTQPQSHFDUISB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |