C46H38N2 — CID 145353137
10,11-bis(ethenyl)-9-(4-methylphenyl)spiro[benzo[c]fluorene-7,9'-fluorene];(3Z)-hexa-1,3,5-triene-3,4-diamine (PubChem CID 145353137) has the molecular formula C46H38N2 and a molecular weight of 618.82 g/mol. Its IUPAC name is 10,11-bis(ethenyl)-9-(4-methylphenyl)spiro[benzo[c]fluorene-7,9'-fluorene];(3Z)-hexa-1,3,5-triene-3,4-diamine.
| Compound Name | 10,11-bis(ethenyl)-9-(4-methylphenyl)spiro[benzo[c]fluorene-7,9'-fluorene];(3Z)-hexa-1,3,5-triene-3,4-diamine |
|---|---|
| PubChem CID | 145353137 |
| Molecular Formula | C46H38N2 |
| Molecular Weight | 618.82 g/mol |
| Exact Mass | 618.30 |
| IUPAC Name | 10,11-bis(ethenyl)-9-(4-methylphenyl)spiro[benzo[c]fluorene-7,9'-fluorene];(3Z)-hexa-1,3,5-triene-3,4-diamine |
| SMILES | C=C/C(N)=C(/N)C=C.C=Cc1c(-c2ccc(C)cc2)cc2c(c1C=C)-c1c(ccc3ccccc13)C21c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C40H28.C6H10N2/c1-4-28-29(5-2)38-37(24-33(28)27-20-18-25(3)19-21-27)40(36-23-22-26-12-6-7-13-30(26)39(36)38)34-16-10-8-14-31(34)32-15-9-11-17-35(32)40;1-3-5(7)6(8)4-2/h4-24H,1-2H2,3H3;3-4H,1-2,7-8H2/b;6-5- |
| InChIKey | CXUYTNDBUFAZHV-JXGYXAOLSA-N |
| XLogP | 10.93 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.82 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|