C47H40N2 — CID 145353487
10,11-bis(ethenyl)-9-(4-methylphenyl)spiro[benzo[c]fluorene-7,9'-fluorene];(3Z)-4-N-methylhexa-1,3,5-triene-3,4-diamine (PubChem CID 145353487) has the molecular formula C47H40N2 and a molecular weight of 632.85 g/mol. Its IUPAC name is 10,11-bis(ethenyl)-9-(4-methylphenyl)spiro[benzo[c]fluorene-7,9'-fluorene];(3Z)-4-N-methylhexa-1,3,5-triene-3,4-diamine.
| Compound Name | 10,11-bis(ethenyl)-9-(4-methylphenyl)spiro[benzo[c]fluorene-7,9'-fluorene];(3Z)-4-N-methylhexa-1,3,5-triene-3,4-diamine |
|---|---|
| PubChem CID | 145353487 |
| Molecular Formula | C47H40N2 |
| Molecular Weight | 632.85 g/mol |
| Exact Mass | 632.32 |
| IUPAC Name | 10,11-bis(ethenyl)-9-(4-methylphenyl)spiro[benzo[c]fluorene-7,9'-fluorene];(3Z)-4-N-methylhexa-1,3,5-triene-3,4-diamine |
| SMILES | C=C/C(N)=C(\C=C)NC.C=Cc1c(-c2ccc(C)cc2)cc2c(c1C=C)-c1c(ccc3ccccc13)C21c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C40H28.C7H12N2/c1-4-28-29(5-2)38-37(24-33(28)27-20-18-25(3)19-21-27)40(36-23-22-26-12-6-7-13-30(26)39(36)38)34-16-10-8-14-31(34)32-15-9-11-17-35(32)40;1-4-6(8)7(5-2)9-3/h4-24H,1-2H2,3H3;4-5,9H,1-2,8H2,3H3/b;7-6- |
| InChIKey | DIGZUNMBRJSZTI-VDXOJYAPSA-N |
| XLogP | 11.19 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.85 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|