C10H16O — CID 145353865
3-butyl-2,5-dimethylideneoxolane (PubChem CID 145353865) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is 3-butyl-2,5-dimethylideneoxolane.
| Compound Name | 3-butyl-2,5-dimethylideneoxolane |
|---|---|
| PubChem CID | 145353865 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 3-butyl-2,5-dimethylideneoxolane |
| SMILES | C=C1CC(CCCC)C(=C)O1 |
| InChI | InChI=1S/C10H16O/c1-4-5-6-10-7-8(2)11-9(10)3/h10H,2-7H2,1H3 |
| InChIKey | DSLZDWZDRIRNPO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |