C21H12N2O2S — CID 145354005
15-(2-nitrophenyl)-8-thia-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene (PubChem CID 145354005) has the molecular formula C21H12N2O2S and a molecular weight of 356.41 g/mol. Its IUPAC name is 15-(2-nitrophenyl)-8-thia-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene.
| Compound Name | 15-(2-nitrophenyl)-8-thia-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene |
|---|---|
| PubChem CID | 145354005 |
| Molecular Formula | C21H12N2O2S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 15-(2-nitrophenyl)-8-thia-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene |
| SMILES | O=[N+]([O-])c1ccccc1-c1cc2c3c(nccc3c1)Sc1ccccc1-2 |
| InChI | InChI=1S/C21H12N2O2S/c24-23(25)18-7-3-1-5-15(18)14-11-13-9-10-22-21-20(13)17(12-14)16-6-2-4-8-19(16)26-21/h1-12H |
| InChIKey | ICCOLELBLVHFQC-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|