C24H38O3 — CID 145356022
(5R)-2,3-dimethoxy-6-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one (PubChem CID 145356022) has the molecular formula C24H38O3 and a molecular weight of 374.57 g/mol. Its IUPAC name is (5R)-2,3-dimethoxy-6-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one.
| Compound Name | (5R)-2,3-dimethoxy-6-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 145356022 |
| Molecular Formula | C24H38O3 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | (5R)-2,3-dimethoxy-6-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one |
| SMILES | COC1=C(OC)C(=O)C(C)[C@H](C/C=C(\C)CC/C=C(\C)CCC=C(C)C)C1 |
| InChI | InChI=1S/C24H38O3/c1-17(2)10-8-11-18(3)12-9-13-19(4)14-15-21-16-22(26-6)24(27-7)23(25)20(21)5/h10,12,14,20-21H,8-9,11,13,15-16H2,1-7H3/b18-12+,19-14+/t20?,21-/m1/s1 |
| InChIKey | XHWDZSBFYMWYLY-VIDPBFMHSA-N |
| XLogP | 6.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|