C43H49NO3 — CID 145357131
butane;[4-[9-(dimethylamino)-11-(4-methoxyphenyl)benzo[a]fluoren-11-yl]phenyl] 2-ethyl-2-methylbutanoate (PubChem CID 145357131) has the molecular formula C43H49NO3 and a molecular weight of 627.87 g/mol. Its IUPAC name is butane;[4-[9-(dimethylamino)-11-(4-methoxyphenyl)benzo[a]fluoren-11-yl]phenyl] 2-ethyl-2-methylbutanoate.
| Compound Name | butane;[4-[9-(dimethylamino)-11-(4-methoxyphenyl)benzo[a]fluoren-11-yl]phenyl] 2-ethyl-2-methylbutanoate |
|---|---|
| PubChem CID | 145357131 |
| Molecular Formula | C43H49NO3 |
| Molecular Weight | 627.87 g/mol |
| Exact Mass | 627.37 |
| IUPAC Name | butane;[4-[9-(dimethylamino)-11-(4-methoxyphenyl)benzo[a]fluoren-11-yl]phenyl] 2-ethyl-2-methylbutanoate |
| SMILES | CCC(C)(CC)C(=O)Oc1ccc(C2(c3ccc(OC)cc3)c3cc(N(C)C)ccc3-c3ccc4ccccc4c32)cc1.CCCC |
| InChI | InChI=1S/C39H39NO3.C4H10/c1-7-38(3,8-2)37(41)43-31-21-16-28(17-22-31)39(27-14-19-30(42-6)20-15-27)35-25-29(40(4)5)18-24-33(35)34-23-13-26-11-9-10-12-32(26)36(34)39;1-3-4-2/h9-25H,7-8H2,1-6H3;3-4H2,1-2H3 |
| InChIKey | VIGOEMMRZCYHKP-UHFFFAOYSA-N |
| XLogP | 10.82 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.87 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|