C32H44FN3O3 — CID 145357336
4-[(1E)-1-aminobuta-1,3-dienyl]-2-but-1-ynyl-N-[3-fluoro-4-(methoxymethyl)phenyl]-5-methyl-1-(1-methylcyclopropyl)pyrrole-3-carboxamide;1-propoxypropane (PubChem CID 145357336) has the molecular formula C32H44FN3O3 and a molecular weight of 537.72 g/mol. Its IUPAC name is 4-[(1E)-1-aminobuta-1,3-dienyl]-2-but-1-ynyl-N-[3-fluoro-4-(methoxymethyl)phenyl]-5-methyl-1-(1-methylcyclopropyl)pyrrole-3-carboxamide;1-propoxypropane.
| Compound Name | 4-[(1E)-1-aminobuta-1,3-dienyl]-2-but-1-ynyl-N-[3-fluoro-4-(methoxymethyl)phenyl]-5-methyl-1-(1-methylcyclopropyl)pyrrole-3-carboxamide;1-propoxypropane |
|---|---|
| PubChem CID | 145357336 |
| Molecular Formula | C32H44FN3O3 |
| Molecular Weight | 537.72 g/mol |
| Exact Mass | 537.34 |
| IUPAC Name | 4-[(1E)-1-aminobuta-1,3-dienyl]-2-but-1-ynyl-N-[3-fluoro-4-(methoxymethyl)phenyl]-5-methyl-1-(1-methylcyclopropyl)pyrrole-3-carboxamide;1-propoxypropane |
| SMILES | C=C/C=C(/N)c1c(C(=O)Nc2ccc(COC)c(F)c2)c(C#CCC)n(C2(C)CC2)c1C.CCCOCCC |
| InChI | InChI=1S/C26H30FN3O2.C6H14O/c1-6-8-10-22-24(25(31)29-19-12-11-18(16-32-5)20(27)15-19)23(21(28)9-7-2)17(3)30(22)26(4)13-14-26;1-3-5-7-6-4-2/h7,9,11-12,15H,2,6,13-14,16,28H2,1,3-5H3,(H,29,31);3-6H2,1-2H3/b21-9+; |
| InChIKey | ORTKYQPQOQPANE-CSFJJMQLSA-N |
| XLogP | 6.91 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.72 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|