C55H55BO — CID 145357913
ethane;2-[3-[(3Z,9Z)-7-methylidene-8-propan-2-ylidenedodeca-3,9,11-trien-5-yl]benzo[b][1]benzoborol-5-yl]dibenzofuran;1-methyl-4-phenylbenzene (PubChem CID 145357913) has the molecular formula C55H55BO and a molecular weight of 742.86 g/mol. Its IUPAC name is ethane;2-[3-[(3Z,9Z)-7-methylidene-8-propan-2-ylidenedodeca-3,9,11-trien-5-yl]benzo[b][1]benzoborol-5-yl]dibenzofuran;1-methyl-4-phenylbenzene.
| Compound Name | ethane;2-[3-[(3Z,9Z)-7-methylidene-8-propan-2-ylidenedodeca-3,9,11-trien-5-yl]benzo[b][1]benzoborol-5-yl]dibenzofuran;1-methyl-4-phenylbenzene |
|---|---|
| PubChem CID | 145357913 |
| Molecular Formula | C55H55BO |
| Molecular Weight | 742.86 g/mol |
| Exact Mass | 742.43 |
| IUPAC Name | ethane;2-[3-[(3Z,9Z)-7-methylidene-8-propan-2-ylidenedodeca-3,9,11-trien-5-yl]benzo[b][1]benzoborol-5-yl]dibenzofuran;1-methyl-4-phenylbenzene |
| SMILES | C=C/C=C\C(C(=C)CC(/C=C\CC)c1ccc2c(c1)B(c1ccc3oc4ccccc4c3c1)c1ccccc1-2)=C(C)C.CC.Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C40H37BO.C13H12.C2H6/c1-6-8-14-29(24-28(5)32(27(3)4)15-9-7-2)30-20-22-34-33-16-10-12-18-37(33)41(38(34)25-30)31-21-23-40-36(26-31)35-17-11-13-19-39(35)42-40;1-11-7-9-13(10-8-11)12-5-3-2-4-6-12;1-2/h7-23,25-26,29H,2,5-6,24H2,1,3-4H3;2-10H,1H3;1-2H3/b14-8-,15-9-;; |
| InChIKey | AMEFKOSLLGJWDA-HQIQWLCFSA-N |
| XLogP | 13.85 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.86 |
| LogP ≤ 5 | 13.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|