C32H31BO3 — CID 145358304
2,3-dimethyl-3-[methyl(spiro[fluorene-9,9'-xanthene]-2'-yl)boranyl]oxybutan-2-ol (PubChem CID 145358304) has the molecular formula C32H31BO3 and a molecular weight of 474.41 g/mol. Its IUPAC name is 2,3-dimethyl-3-[methyl(spiro[fluorene-9,9'-xanthene]-2'-yl)boranyl]oxybutan-2-ol.
| Compound Name | 2,3-dimethyl-3-[methyl(spiro[fluorene-9,9'-xanthene]-2'-yl)boranyl]oxybutan-2-ol |
|---|---|
| PubChem CID | 145358304 |
| Molecular Formula | C32H31BO3 |
| Molecular Weight | 474.41 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | 2,3-dimethyl-3-[methyl(spiro[fluorene-9,9'-xanthene]-2'-yl)boranyl]oxybutan-2-ol |
| SMILES | CB(OC(C)(C)C(C)(C)O)c1ccc2c(c1)C1(c3ccccc3O2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C32H31BO3/c1-30(2,34)31(3,4)36-33(5)21-18-19-29-27(20-21)32(26-16-10-11-17-28(26)35-29)24-14-8-6-12-22(24)23-13-7-9-15-25(23)32/h6-20,34H,1-5H3 |
| InChIKey | ZOJYULTWDXXRHL-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.41 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|