C21H20F2N2 — CID 145359054
N'-[[3,5-bis(4-fluorophenyl)phenyl]methyl]ethane-1,2-diamine (PubChem CID 145359054) has the molecular formula C21H20F2N2 and a molecular weight of 338.40 g/mol. Its IUPAC name is N'-[[3,5-bis(4-fluorophenyl)phenyl]methyl]ethane-1,2-diamine.
| Compound Name | N'-[[3,5-bis(4-fluorophenyl)phenyl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 145359054 |
| Molecular Formula | C21H20F2N2 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N'-[[3,5-bis(4-fluorophenyl)phenyl]methyl]ethane-1,2-diamine |
| SMILES | NCCNCc1cc(-c2ccc(F)cc2)cc(-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C21H20F2N2/c22-20-5-1-16(2-6-20)18-11-15(14-25-10-9-24)12-19(13-18)17-3-7-21(23)8-4-17/h1-8,11-13,25H,9-10,14,24H2 |
| InChIKey | MYLQUAQTFASRSO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|