C16H14Cl2N2O — CID 14535906
2-chloro-N-(1-chloro-3-methyl-2,3-dihydro-1H-inden-4-yl)pyridine-3-carboxamide (PubChem CID 14535906) has the molecular formula C16H14Cl2N2O and a molecular weight of 321.21 g/mol. Its IUPAC name is 2-chloro-N-(1-chloro-3-methyl-2,3-dihydro-1H-inden-4-yl)pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-(1-chloro-3-methyl-2,3-dihydro-1H-inden-4-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 14535906 |
| Molecular Formula | C16H14Cl2N2O |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 2-chloro-N-(1-chloro-3-methyl-2,3-dihydro-1H-inden-4-yl)pyridine-3-carboxamide |
| SMILES | CC1CC(Cl)c2cccc(NC(=O)c3cccnc3Cl)c21 |
| InChI | InChI=1S/C16H14Cl2N2O/c1-9-8-12(17)10-4-2-6-13(14(9)10)20-16(21)11-5-3-7-19-15(11)18/h2-7,9,12H,8H2,1H3,(H,20,21) |
| InChIKey | UKTRMEIBXZRVPV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|