C17H17ClN2O — CID 14535901
2-chloro-N-(1,1-dimethyl-2,3-dihydroinden-4-yl)pyridine-3-carboxamide (PubChem CID 14535901) has the molecular formula C17H17ClN2O and a molecular weight of 300.79 g/mol. Its IUPAC name is 2-chloro-N-(1,1-dimethyl-2,3-dihydroinden-4-yl)pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-(1,1-dimethyl-2,3-dihydroinden-4-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 14535901 |
| Molecular Formula | C17H17ClN2O |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 2-chloro-N-(1,1-dimethyl-2,3-dihydroinden-4-yl)pyridine-3-carboxamide |
| SMILES | CC1(C)CCc2c(NC(=O)c3cccnc3Cl)cccc21 |
| InChI | InChI=1S/C17H17ClN2O/c1-17(2)9-8-11-13(17)6-3-7-14(11)20-16(21)12-5-4-10-19-15(12)18/h3-7,10H,8-9H2,1-2H3,(H,20,21) |
| InChIKey | JWAMPRHAFCNLIK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|