C21H18N6O3 — CID 145360613
N-[4-[2-(4-methoxyanilino)-7-oxopteridin-8-yl]phenyl]acetamide (PubChem CID 145360613) has the molecular formula C21H18N6O3 and a molecular weight of 402.41 g/mol. Its IUPAC name is N-[4-[2-(4-methoxyanilino)-7-oxopteridin-8-yl]phenyl]acetamide.
| Compound Name | N-[4-[2-(4-methoxyanilino)-7-oxopteridin-8-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 145360613 |
| Molecular Formula | C21H18N6O3 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | N-[4-[2-(4-methoxyanilino)-7-oxopteridin-8-yl]phenyl]acetamide |
| SMILES | COc1ccc(Nc2ncc3ncc(=O)n(-c4ccc(NC(C)=O)cc4)c3n2)cc1 |
| InChI | InChI=1S/C21H18N6O3/c1-13(28)24-14-3-7-16(8-4-14)27-19(29)12-22-18-11-23-21(26-20(18)27)25-15-5-9-17(30-2)10-6-15/h3-12H,1-2H3,(H,24,28)(H,23,25,26) |
| InChIKey | ZVJHKFBLOAIOQR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |