C18H24O7 — CID 145363038
4-[2-(2-methoxyphenyl)-2-(oxan-4-yloxy)ethoxy]-4-oxobutanoic acid (PubChem CID 145363038) has the molecular formula C18H24O7 and a molecular weight of 352.38 g/mol. Its IUPAC name is 4-[2-(2-methoxyphenyl)-2-(oxan-4-yloxy)ethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-(2-methoxyphenyl)-2-(oxan-4-yloxy)ethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 145363038 |
| Molecular Formula | C18H24O7 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 4-[2-(2-methoxyphenyl)-2-(oxan-4-yloxy)ethoxy]-4-oxobutanoic acid |
| SMILES | COc1ccccc1C(COC(=O)CCC(=O)O)OC1CCOCC1 |
| InChI | InChI=1S/C18H24O7/c1-22-15-5-3-2-4-14(15)16(25-13-8-10-23-11-9-13)12-24-18(21)7-6-17(19)20/h2-5,13,16H,6-12H2,1H3,(H,19,20) |
| InChIKey | KDOOPURHOFZIIO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |