4-[2-(4-ethylphenyl)-4-methyl-1,3-thiazol-5-yl]butanoic acid

C16H19NO2S — CID 145363135

IUPAC4-[2-(4-ethylphenyl)-4-methyl-1,3-thiazol-5-yl]butanoic acid
SMILESCCc1ccc(-c2nc(C)c(CCCC(=O)O)s2)cc1
InChIInChI=1S/C16H19NO2S/c1-3-12-7-9-13(10-8-12)16-17-11(2)14(20-16)5-4-6-15(18)19/h7-10H,3-6H2,1-2H3,(H,18,19)
InChIKeyWZFAIPFUQRCCKA-UHFFFAOYSA-N
MW289.40 g/mol
LogP4.09
Rot. Bonds6

About 4-[2-(4-ethylphenyl)-4-methyl-1,3-thiazol-5-yl]butanoic acid

4-[2-(4-ethylphenyl)-4-methyl-1,3-thiazol-5-yl]butanoic acid (PubChem CID 145363135) has the molecular formula C16H19NO2S and a molecular weight of 289.40 g/mol. Its IUPAC name is 4-[2-(4-ethylphenyl)-4-methyl-1,3-thiazol-5-yl]butanoic acid.

Molecular Properties

Compound Name4-[2-(4-ethylphenyl)-4-methyl-1,3-thiazol-5-yl]butanoic acid
PubChem CID145363135
Molecular FormulaC16H19NO2S
Molecular Weight289.40 g/mol
Exact Mass289.11
IUPAC Name4-[2-(4-ethylphenyl)-4-methyl-1,3-thiazol-5-yl]butanoic acid
SMILESCCc1ccc(-c2nc(C)c(CCCC(=O)O)s2)cc1
InChIInChI=1S/C16H19NO2S/c1-3-12-7-9-13(10-8-12)16-17-11(2)14(20-16)5-4-6-15(18)19/h7-10H,3-6H2,1-2H3,(H,18,19)
InChIKeyWZFAIPFUQRCCKA-UHFFFAOYSA-N
XLogP4.09
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.40
LogP ≤ 54.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-[2-(4-ethylphenyl)-4-methyl-1,3-thiazol-5-yl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[2-(4-ethylphenyl)-4-methyl-1,3-thiazol-5-yl]butanoic acid?
The IUPAC name of 4-[2-(4-ethylphenyl)-4-methyl-1,3-thiazol-5-yl]butanoic acid (CID 145363135) is 4-[2-(4-ethylphenyl)-4-methyl-1,3-thiazol-5-yl]butanoic acid.
What is the SMILES notation for 4-[2-(4-ethylphenyl)-4-methyl-1,3-thiazol-5-yl]butanoic acid?
The canonical SMILES for 4-[2-(4-ethylphenyl)-4-methyl-1,3-thiazol-5-yl]butanoic acid is CCc1ccc(-c2nc(C)c(CCCC(=O)O)s2)cc1.
What is the InChIKey of 4-[2-(4-ethylphenyl)-4-methyl-1,3-thiazol-5-yl]butanoic acid?
The InChIKey is WZFAIPFUQRCCKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO2S/c1-3-12-7-9-13(10-8-12)16-17-11(2)14(20-16)5-4-6-15(18)19/h7-10H,3-6H2,1-2H3,(H,18,19).
What are the key properties of 4-[2-(4-ethylphenyl)-4-methyl-1,3-thiazol-5-yl]butanoic acid?
4-[2-(4-ethylphenyl)-4-methyl-1,3-thiazol-5-yl]butanoic acid has a molecular weight of 289.40 g/mol, XLogP of 4.09, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4-ethylphenyl)-4-methyl-1,3-thiazol-5-yl]butanoic acid is sourced from PubChem (CID 145363135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).