C14H18F14N2O — CID 145366174
N'-ethyl-N'-[1,1,1,3,3-pentafluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)butan-2-yl]-N-(trifluoromethyl)propane-1,3-diamine (PubChem CID 145366174) has the molecular formula C14H18F14N2O and a molecular weight of 496.28 g/mol. Its IUPAC name is N'-ethyl-N'-[1,1,1,3,3-pentafluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)butan-2-yl]-N-(trifluoromethyl)propane-1,3-diamine.
| Compound Name | N'-ethyl-N'-[1,1,1,3,3-pentafluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)butan-2-yl]-N-(trifluoromethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 145366174 |
| Molecular Formula | C14H18F14N2O |
| Molecular Weight | 496.28 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | N'-ethyl-N'-[1,1,1,3,3-pentafluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)butan-2-yl]-N-(trifluoromethyl)propane-1,3-diamine |
| SMILES | CCN(CCCNC(F)(F)F)C(C(F)(F)F)C(F)(F)COCC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C14H18F14N2O/c1-2-30(5-3-4-29-14(26,27)28)9(13(23,24)25)11(18,19)7-31-6-10(16,17)8(15)12(20,21)22/h8-9,29H,2-7H2,1H3 |
| InChIKey | CUSYZUFCFNKIMN-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.28 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|