C15H20F14N2O — CID 145366179
N'-ethyl-N'-[1,1,1,3,3-pentafluoro-4-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)pentan-2-yl]-N-(trifluoromethyl)ethane-1,2-diamine (PubChem CID 145366179) has the molecular formula C15H20F14N2O and a molecular weight of 510.31 g/mol. Its IUPAC name is N'-ethyl-N'-[1,1,1,3,3-pentafluoro-4-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)pentan-2-yl]-N-(trifluoromethyl)ethane-1,2-diamine.
| Compound Name | N'-ethyl-N'-[1,1,1,3,3-pentafluoro-4-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)pentan-2-yl]-N-(trifluoromethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 145366179 |
| Molecular Formula | C15H20F14N2O |
| Molecular Weight | 510.31 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | N'-ethyl-N'-[1,1,1,3,3-pentafluoro-4-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)pentan-2-yl]-N-(trifluoromethyl)ethane-1,2-diamine |
| SMILES | CCN(CCNC(F)(F)F)C(C(F)(F)F)C(F)(F)C(C)OC(C)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C15H20F14N2O/c1-4-31(6-5-30-15(27,28)29)10(14(24,25)26)12(19,20)8(3)32-7(2)11(17,18)9(16)13(21,22)23/h7-10,30H,4-6H2,1-3H3 |
| InChIKey | SSRGAFYYEFZHKH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.31 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|