C23H32FNO3S — CID 145366950
ethane;4-ethyl-N-methoxy-3-methylbenzamide;2-[1-(4-fluorophenyl)ethylsulfanyl]acetaldehyde (PubChem CID 145366950) has the molecular formula C23H32FNO3S and a molecular weight of 421.58 g/mol. Its IUPAC name is ethane;4-ethyl-N-methoxy-3-methylbenzamide;2-[1-(4-fluorophenyl)ethylsulfanyl]acetaldehyde.
| Compound Name | ethane;4-ethyl-N-methoxy-3-methylbenzamide;2-[1-(4-fluorophenyl)ethylsulfanyl]acetaldehyde |
|---|---|
| PubChem CID | 145366950 |
| Molecular Formula | C23H32FNO3S |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | ethane;4-ethyl-N-methoxy-3-methylbenzamide;2-[1-(4-fluorophenyl)ethylsulfanyl]acetaldehyde |
| SMILES | CC.CC(SCC=O)c1ccc(F)cc1.CCc1ccc(C(=O)NOC)cc1C |
| InChI | InChI=1S/C11H15NO2.C10H11FOS.C2H6/c1-4-9-5-6-10(7-8(9)2)11(13)12-14-3;1-8(13-7-6-12)9-2-4-10(11)5-3-9;1-2/h5-7H,4H2,1-3H3,(H,12,13);2-6,8H,7H2,1H3;1-2H3 |
| InChIKey | AEAGRJZUFKAUKI-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|