C45H39BN2O2 — CID 145370319
7,7-dimethyl-12-(9-phenylcarbazol-3-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indeno[1,2-a]carbazole (PubChem CID 145370319) has the molecular formula C45H39BN2O2 and a molecular weight of 650.63 g/mol. Its IUPAC name is 7,7-dimethyl-12-(9-phenylcarbazol-3-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indeno[1,2-a]carbazole.
| Compound Name | 7,7-dimethyl-12-(9-phenylcarbazol-3-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indeno[1,2-a]carbazole |
|---|---|
| PubChem CID | 145370319 |
| Molecular Formula | C45H39BN2O2 |
| Molecular Weight | 650.63 g/mol |
| Exact Mass | 650.31 |
| IUPAC Name | 7,7-dimethyl-12-(9-phenylcarbazol-3-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indeno[1,2-a]carbazole |
| SMILES | CC1(C)c2ccccc2-c2c1cc(B1OC(C)(C)C(C)(C)O1)c1c3ccccc3n(-c3ccc4c(c3)c3ccccc3n4-c3ccccc3)c21 |
| InChI | InChI=1S/C45H39BN2O2/c1-43(2)34-21-13-10-19-31(34)40-35(43)27-36(46-49-44(3,4)45(5,6)50-46)41-32-20-12-15-23-38(32)48(42(40)41)29-24-25-39-33(26-29)30-18-11-14-22-37(30)47(39)28-16-8-7-9-17-28/h7-27H,1-6H3 |
| InChIKey | MZGINHVRQLJTFP-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 28.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.63 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|