C19H28O4 — CID 145371426
7-methylnonyl 3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 145371426) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is 7-methylnonyl 3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | 7-methylnonyl 3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 145371426 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 7-methylnonyl 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | CCC(C)CCCCCCOC(=O)C=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C19H28O4/c1-3-15(2)8-6-4-5-7-13-23-19(22)12-10-16-9-11-17(20)18(21)14-16/h9-12,14-15,20-21H,3-8,13H2,1-2H3 |
| InChIKey | ZBAAAHNEGJBKGA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|