C18H24N6S — CID 145372074
(3-methylphenyl) 4-amino-6-(piperidin-4-ylmethylamino)pyrimidine-5-carboximidothioate (PubChem CID 145372074) has the molecular formula C18H24N6S and a molecular weight of 356.50 g/mol. Its IUPAC name is (3-methylphenyl) 4-amino-6-(piperidin-4-ylmethylamino)pyrimidine-5-carboximidothioate.
| Compound Name | (3-methylphenyl) 4-amino-6-(piperidin-4-ylmethylamino)pyrimidine-5-carboximidothioate |
|---|---|
| PubChem CID | 145372074 |
| Molecular Formula | C18H24N6S |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | (3-methylphenyl) 4-amino-6-(piperidin-4-ylmethylamino)pyrimidine-5-carboximidothioate |
| SMILES | [H]/N=C(\Sc1cccc(C)c1)c1c(N)ncnc1NCC1CCNCC1 |
| InChI | InChI=1S/C18H24N6S/c1-12-3-2-4-14(9-12)25-17(20)15-16(19)23-11-24-18(15)22-10-13-5-7-21-8-6-13/h2-4,9,11,13,20-21H,5-8,10H2,1H3,(H3,19,22,23,24)/b20-17- |
| InChIKey | KNALIWMHYVREKF-JZJYNLBNSA-N |
| XLogP | 2.90 |
| TPSA | 99.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|