C17H19ClF2N6S — CID 130434594
(3-chlorophenyl) 4-amino-6-[(3,3-difluoropiperidin-4-yl)methylamino]pyrimidine-5-carboximidothioate (PubChem CID 130434594) has the molecular formula C17H19ClF2N6S and a molecular weight of 412.90 g/mol. Its IUPAC name is (3-chlorophenyl) 4-amino-6-[(3,3-difluoropiperidin-4-yl)methylamino]pyrimidine-5-carboximidothioate.
| Compound Name | (3-chlorophenyl) 4-amino-6-[(3,3-difluoropiperidin-4-yl)methylamino]pyrimidine-5-carboximidothioate |
|---|---|
| PubChem CID | 130434594 |
| Molecular Formula | C17H19ClF2N6S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | (3-chlorophenyl) 4-amino-6-[(3,3-difluoropiperidin-4-yl)methylamino]pyrimidine-5-carboximidothioate |
| SMILES | [H]/N=C(\Sc1cccc(Cl)c1)c1c(N)ncnc1NCC1CCNCC1(F)F |
| InChI | InChI=1S/C17H19ClF2N6S/c18-11-2-1-3-12(6-11)27-15(22)13-14(21)25-9-26-16(13)24-7-10-4-5-23-8-17(10,19)20/h1-3,6,9-10,22-23H,4-5,7-8H2,(H3,21,24,25,26)/b22-15- |
| InChIKey | JJEIDFCYESFOBS-JCMHNJIXSA-N |
| XLogP | 3.49 |
| TPSA | 99.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|