C17H21ClN6S — CID 130434595
(3-chlorophenyl) 4-amino-6-(piperidin-4-ylmethylamino)pyrimidine-5-carboximidothioate (PubChem CID 130434595) has the molecular formula C17H21ClN6S and a molecular weight of 376.92 g/mol. Its IUPAC name is (3-chlorophenyl) 4-amino-6-(piperidin-4-ylmethylamino)pyrimidine-5-carboximidothioate.
| Compound Name | (3-chlorophenyl) 4-amino-6-(piperidin-4-ylmethylamino)pyrimidine-5-carboximidothioate |
|---|---|
| PubChem CID | 130434595 |
| Molecular Formula | C17H21ClN6S |
| Molecular Weight | 376.92 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | (3-chlorophenyl) 4-amino-6-(piperidin-4-ylmethylamino)pyrimidine-5-carboximidothioate |
| SMILES | [H]/N=C(\Sc1cccc(Cl)c1)c1c(N)ncnc1NCC1CCNCC1 |
| InChI | InChI=1S/C17H21ClN6S/c18-12-2-1-3-13(8-12)25-16(20)14-15(19)23-10-24-17(14)22-9-11-4-6-21-7-5-11/h1-3,8,10-11,20-21H,4-7,9H2,(H3,19,22,23,24)/b20-16- |
| InChIKey | DPMOXQACGHQSNR-SILNSSARSA-N |
| XLogP | 3.24 |
| TPSA | 99.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.92 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|