C15H20O3 — CID 145372186
8a-ethyl-3-methoxy-7,8-dimethyl-5,8-dihydro-4aH-naphthalene-1,4-dione (PubChem CID 145372186) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 8a-ethyl-3-methoxy-7,8-dimethyl-5,8-dihydro-4aH-naphthalene-1,4-dione.
| Compound Name | 8a-ethyl-3-methoxy-7,8-dimethyl-5,8-dihydro-4aH-naphthalene-1,4-dione |
|---|---|
| PubChem CID | 145372186 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 8a-ethyl-3-methoxy-7,8-dimethyl-5,8-dihydro-4aH-naphthalene-1,4-dione |
| SMILES | CCC12C(=O)C=C(OC)C(=O)C1CC=C(C)C2C |
| InChI | InChI=1S/C15H20O3/c1-5-15-10(3)9(2)6-7-11(15)14(17)12(18-4)8-13(15)16/h6,8,10-11H,5,7H2,1-4H3 |
| InChIKey | GKXSCDYNQXQECS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|