C53H56N2O6 — CID 145373546
2-[4-(4-methylheptan-4-yl)phenyl]-5-[4-[2-[4-[2-(4-methylhept-2-en-4-yl)-1,3-dioxoisoindol-5-yl]oxyphenyl]propan-2-yl]phenoxy]isoindole-1,3-dione (PubChem CID 145373546) has the molecular formula C53H56N2O6 and a molecular weight of 817.04 g/mol. Its IUPAC name is 2-[4-(4-methylheptan-4-yl)phenyl]-5-[4-[2-[4-[2-(4-methylhept-2-en-4-yl)-1,3-dioxoisoindol-5-yl]oxyphenyl]propan-2-yl]phenoxy]isoindole-1,3-dione.
| Compound Name | 2-[4-(4-methylheptan-4-yl)phenyl]-5-[4-[2-[4-[2-(4-methylhept-2-en-4-yl)-1,3-dioxoisoindol-5-yl]oxyphenyl]propan-2-yl]phenoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 145373546 |
| Molecular Formula | C53H56N2O6 |
| Molecular Weight | 817.04 g/mol |
| Exact Mass | 816.41 |
| IUPAC Name | 2-[4-(4-methylheptan-4-yl)phenyl]-5-[4-[2-[4-[2-(4-methylhept-2-en-4-yl)-1,3-dioxoisoindol-5-yl]oxyphenyl]propan-2-yl]phenoxy]isoindole-1,3-dione |
| SMILES | CC=CC(C)(CCC)N1C(=O)c2ccc(Oc3ccc(C(C)(C)c4ccc(Oc5ccc6c(c5)C(=O)N(c5ccc(C(C)(CCC)CCC)cc5)C6=O)cc4)cc3)cc2C1=O |
| InChI | InChI=1S/C53H56N2O6/c1-9-29-52(7,30-10-2)37-13-19-38(20-14-37)54-47(56)43-27-25-41(33-45(43)48(54)57)60-39-21-15-35(16-22-39)51(5,6)36-17-23-40(24-18-36)61-42-26-28-44-46(34-42)50(59)55(49(44)58)53(8,31-11-3)32-12-4/h11,13-28,31,33-34H,9-10,12,29-30,32H2,1-8H3 |
| InChIKey | DVOIUOUVLJMWIU-UHFFFAOYSA-N |
| XLogP | 12.99 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.04 |
| LogP ≤ 5 | 12.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|