C38H36N2O5 — CID 142178546
2-[4-(4-tert-butylphenoxy)phenyl]-5-[2-(3-methylpentan-3-yl)-1,3-dioxoisoindol-5-yl]isoindole-1,3-dione (PubChem CID 142178546) has the molecular formula C38H36N2O5 and a molecular weight of 600.72 g/mol. Its IUPAC name is 2-[4-(4-tert-butylphenoxy)phenyl]-5-[2-(3-methylpentan-3-yl)-1,3-dioxoisoindol-5-yl]isoindole-1,3-dione.
| Compound Name | 2-[4-(4-tert-butylphenoxy)phenyl]-5-[2-(3-methylpentan-3-yl)-1,3-dioxoisoindol-5-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 142178546 |
| Molecular Formula | C38H36N2O5 |
| Molecular Weight | 600.72 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | 2-[4-(4-tert-butylphenoxy)phenyl]-5-[2-(3-methylpentan-3-yl)-1,3-dioxoisoindol-5-yl]isoindole-1,3-dione |
| SMILES | CCC(C)(CC)N1C(=O)c2ccc(-c3ccc4c(c3)C(=O)N(c3ccc(Oc5ccc(C(C)(C)C)cc5)cc3)C4=O)cc2C1=O |
| InChI | InChI=1S/C38H36N2O5/c1-7-38(6,8-2)40-35(43)30-20-10-24(22-32(30)36(40)44)23-9-19-29-31(21-23)34(42)39(33(29)41)26-13-17-28(18-14-26)45-27-15-11-25(12-16-27)37(3,4)5/h9-22H,7-8H2,1-6H3 |
| InChIKey | PQTFIMZJEAAXRQ-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.72 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|