C32H29NO4 — CID 71248056
5-methyl-2-[4-[3-[4-(2-methylbutan-2-yl)phenoxy]phenoxy]phenyl]isoindole-1,3-dione (PubChem CID 71248056) has the molecular formula C32H29NO4 and a molecular weight of 491.59 g/mol. Its IUPAC name is 5-methyl-2-[4-[3-[4-(2-methylbutan-2-yl)phenoxy]phenoxy]phenyl]isoindole-1,3-dione.
| Compound Name | 5-methyl-2-[4-[3-[4-(2-methylbutan-2-yl)phenoxy]phenoxy]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 71248056 |
| Molecular Formula | C32H29NO4 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 5-methyl-2-[4-[3-[4-(2-methylbutan-2-yl)phenoxy]phenoxy]phenyl]isoindole-1,3-dione |
| SMILES | CCC(C)(C)c1ccc(Oc2cccc(Oc3ccc(N4C(=O)c5ccc(C)cc5C4=O)cc3)c2)cc1 |
| InChI | InChI=1S/C32H29NO4/c1-5-32(3,4)22-10-14-24(15-11-22)36-26-7-6-8-27(20-26)37-25-16-12-23(13-17-25)33-30(34)28-18-9-21(2)19-29(28)31(33)35/h6-20H,5H2,1-4H3 |
| InChIKey | CCEIAFQSZNYEIF-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|