C40H32N2O6 — CID 170205146
2-[4-[5-[4-[2-(4-methoxyphenyl)butan-2-yl]phenoxy]-1,3-dioxoisoindol-2-yl]phenyl]-5-methylisoindole-1,3-dione (PubChem CID 170205146) has the molecular formula C40H32N2O6 and a molecular weight of 636.70 g/mol. Its IUPAC name is 2-[4-[5-[4-[2-(4-methoxyphenyl)butan-2-yl]phenoxy]-1,3-dioxoisoindol-2-yl]phenyl]-5-methylisoindole-1,3-dione.
| Compound Name | 2-[4-[5-[4-[2-(4-methoxyphenyl)butan-2-yl]phenoxy]-1,3-dioxoisoindol-2-yl]phenyl]-5-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 170205146 |
| Molecular Formula | C40H32N2O6 |
| Molecular Weight | 636.70 g/mol |
| Exact Mass | 636.23 |
| IUPAC Name | 2-[4-[5-[4-[2-(4-methoxyphenyl)butan-2-yl]phenoxy]-1,3-dioxoisoindol-2-yl]phenyl]-5-methylisoindole-1,3-dione |
| SMILES | CCC(C)(c1ccc(OC)cc1)c1ccc(Oc2ccc3c(c2)C(=O)N(c2ccc(N4C(=O)c5ccc(C)cc5C4=O)cc2)C3=O)cc1 |
| InChI | InChI=1S/C40H32N2O6/c1-5-40(3,25-7-15-29(47-4)16-8-25)26-9-17-30(18-10-26)48-31-19-21-33-35(23-31)39(46)42(37(33)44)28-13-11-27(12-14-28)41-36(43)32-20-6-24(2)22-34(32)38(41)45/h6-23H,5H2,1-4H3 |
| InChIKey | QNKBOVDMHHTIFJ-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.70 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|