C40H33NO7 — CID 70897504
2-[2-[3-[5-[4-[2-(4-methoxyphenyl)propan-2-yl]phenoxy]-1,3-dioxoisoindol-2-yl]phenyl]acetyl]-4-methylbenzoic acid (PubChem CID 70897504) has the molecular formula C40H33NO7 and a molecular weight of 639.70 g/mol. Its IUPAC name is 2-[2-[3-[5-[4-[2-(4-methoxyphenyl)propan-2-yl]phenoxy]-1,3-dioxoisoindol-2-yl]phenyl]acetyl]-4-methylbenzoic acid.
| Compound Name | 2-[2-[3-[5-[4-[2-(4-methoxyphenyl)propan-2-yl]phenoxy]-1,3-dioxoisoindol-2-yl]phenyl]acetyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 70897504 |
| Molecular Formula | C40H33NO7 |
| Molecular Weight | 639.70 g/mol |
| Exact Mass | 639.23 |
| IUPAC Name | 2-[2-[3-[5-[4-[2-(4-methoxyphenyl)propan-2-yl]phenoxy]-1,3-dioxoisoindol-2-yl]phenyl]acetyl]-4-methylbenzoic acid |
| SMILES | COc1ccc(C(C)(C)c2ccc(Oc3ccc4c(c3)C(=O)N(c3cccc(CC(=O)c5cc(C)ccc5C(=O)O)c3)C4=O)cc2)cc1 |
| InChI | InChI=1S/C40H33NO7/c1-24-8-18-33(39(45)46)34(20-24)36(42)22-25-6-5-7-28(21-25)41-37(43)32-19-17-31(23-35(32)38(41)44)48-30-15-11-27(12-16-30)40(2,3)26-9-13-29(47-4)14-10-26/h5-21,23H,22H2,1-4H3,(H,45,46) |
| InChIKey | KRGOALZRDYJVSA-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.70 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|