C24H19NO5 — CID 1726514
Propyl 1,3-dioxo-2-(4-phenoxyphenyl)-5-isoindolinecarboxylate (PubChem CID 1726514) has the molecular formula C24H19NO5 and a molecular weight of 401.40 g/mol. Its IUPAC name is propyl 1,3-dioxo-2-(4-phenoxyphenyl)isoindole-5-carboxylate.
| Compound Name | Propyl 1,3-dioxo-2-(4-phenoxyphenyl)-5-isoindolinecarboxylate |
|---|---|
| PubChem CID | 1726514 |
| Molecular Formula | C24H19NO5 |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | propyl 1,3-dioxo-2-(4-phenoxyphenyl)isoindole-5-carboxylate |
| SMILES | CCCOC(=O)C1=CC2=C(C=C1)C(=O)N(C2=O)C3=CC=C(C=C3)OC4=CC=CC=C4 |
| InChI | InChI=1S/C24H19NO5/c1-2-14-29-24(28)16-8-13-20-21(15-16)23(27)25(22(20)26)17-9-11-19(12-10-17)30-18-6-4-3-5-7-18/h3-13,15H,2,14H2,1H3 |
| InChIKey | PWGJSHFRDVKCOX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 72.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | 636 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|