C37H36N2O5 — CID 118066249
6-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]-13-(3-methylpentan-3-yl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 118066249) has the molecular formula C37H36N2O5 and a molecular weight of 588.70 g/mol. Its IUPAC name is 6-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]-13-(3-methylpentan-3-yl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]-13-(3-methylpentan-3-yl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 118066249 |
| Molecular Formula | C37H36N2O5 |
| Molecular Weight | 588.70 g/mol |
| Exact Mass | 588.26 |
| IUPAC Name | 6-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]-13-(3-methylpentan-3-yl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | CCC(C)(C)c1ccc(Oc2ccc(N3C(=O)c4ccc5c6c(ccc(c46)C3=O)C(=O)N(C(C)(CC)CC)C5=O)cc2)cc1 |
| InChI | InChI=1S/C37H36N2O5/c1-7-36(4,5)22-10-14-24(15-11-22)44-25-16-12-23(13-17-25)38-32(40)26-18-20-28-31-29(21-19-27(30(26)31)33(38)41)35(43)39(34(28)42)37(6,8-2)9-3/h10-21H,7-9H2,1-6H3 |
| InChIKey | JVXFTKYRBIRELD-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.70 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|